C18H16N2O3S — CID 5278672
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(3-methylphenyl)carbamothioate (PubChem CID 5278672) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(3-methylphenyl)carbamothioate.
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(3-methylphenyl)carbamothioate |
|---|---|
| PubChem CID | 5278672 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(3-methylphenyl)carbamothioate |
| SMILES | Cc1cccc(NC(=S)OCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-12-5-4-6-13(11-12)19-18(24)23-10-9-20-16(21)14-7-2-3-8-15(14)17(20)22/h2-8,11H,9-10H2,1H3,(H,19,24) |
| InChIKey | SHYDFCVYQLTZNO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|