C24H19N3O4 — CID 8874197
2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(3-methylphenyl)benzamide (PubChem CID 8874197) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(3-methylphenyl)benzamide.
| Compound Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 8874197 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H19N3O4/c1-15-7-6-8-16(13-15)25-22(29)19-11-4-5-12-20(19)26-21(28)14-27-23(30)17-9-2-3-10-18(17)24(27)31/h2-13H,14H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | IQMAERWEOVYPFB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|