C24H18N4O6 — CID 34311901
N-(3-methylphenyl)-2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide (PubChem CID 34311901) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide.
| Compound Name | N-(3-methylphenyl)-2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 34311901 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-(3-methylphenyl)-2-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c1 |
| InChI | InChI=1S/C24H18N4O6/c1-14-5-4-6-15(11-14)25-22(30)18-7-2-3-8-20(18)26-21(29)13-27-23(31)17-10-9-16(28(33)34)12-19(17)24(27)32/h2-12H,13H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | PEZBUCYXQQQELI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|