C18H13N3O7 — CID 17341865
[3-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl] acetate (PubChem CID 17341865) has the molecular formula C18H13N3O7 and a molecular weight of 383.32 g/mol. Its IUPAC name is [3-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl] acetate.
| Compound Name | [3-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 17341865 |
| Molecular Formula | C18H13N3O7 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [3-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c1 |
| InChI | InChI=1S/C18H13N3O7/c1-10(22)28-13-4-2-3-11(7-13)19-16(23)9-20-17(24)14-6-5-12(21(26)27)8-15(14)18(20)25/h2-8H,9H2,1H3,(H,19,23) |
| InChIKey | BLQXWDCOWYRNAK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|