C23H23N5O8 — CID 108916984
tert-butyl N-[2-[4-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108916984) has the molecular formula C23H23N5O8 and a molecular weight of 497.46 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916984 |
| Molecular Formula | C23H23N5O8 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | tert-butyl N-[2-[4-[[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(NC(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C23H23N5O8/c1-23(2,3)36-22(33)24-11-18(29)25-13-4-6-14(7-5-13)26-19(30)12-27-20(31)16-9-8-15(28(34)35)10-17(16)21(27)32/h4-10H,11-12H2,1-3H3,(H,24,33)(H,25,29)(H,26,30) |
| InChIKey | MSGZGQVXDNETIR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|