C22H27N5O8 — CID 108916751
tert-butyl N-[2-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 108916751) has the molecular formula C22H27N5O8 and a molecular weight of 489.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916751 |
| Molecular Formula | C22H27N5O8 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC1CCN(C(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)CC1 |
| InChI | InChI=1S/C22H27N5O8/c1-22(2,3)35-21(32)23-11-17(28)24-13-6-8-25(9-7-13)18(29)12-26-19(30)15-5-4-14(27(33)34)10-16(15)20(26)31/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,23,32)(H,24,28) |
| InChIKey | UUDJEJUEAKDIRY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 168.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|