C25H27N5O8 — CID 108916985
tert-butyl N-[2-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]anilino]-2-oxoethyl]carbamate (PubChem CID 108916985) has the molecular formula C25H27N5O8 and a molecular weight of 525.52 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916985 |
| Molecular Formula | C25H27N5O8 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(NC(=O)CCCN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C25H27N5O8/c1-25(2,3)38-24(35)26-14-21(32)28-16-8-6-15(7-9-16)27-20(31)5-4-12-29-22(33)18-11-10-17(30(36)37)13-19(18)23(29)34/h6-11,13H,4-5,12,14H2,1-3H3,(H,26,35)(H,27,31)(H,28,32) |
| InChIKey | MFHDQMLYKJBSQS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|