C27H31N5O8 — CID 108921346
tert-butyl N-[3-[3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]anilino]-3-oxopropyl]carbamate (PubChem CID 108921346) has the molecular formula C27H31N5O8 and a molecular weight of 553.57 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921346 |
| Molecular Formula | C27H31N5O8 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | tert-butyl N-[3-[3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]anilino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1cccc(CNC(=O)CCCN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c1 |
| InChI | InChI=1S/C27H31N5O8/c1-27(2,3)40-26(37)28-12-11-23(34)30-18-7-4-6-17(14-18)16-29-22(33)8-5-13-31-24(35)20-10-9-19(32(38)39)15-21(20)25(31)36/h4,6-7,9-10,14-15H,5,8,11-13,16H2,1-3H3,(H,28,37)(H,29,33)(H,30,34) |
| InChIKey | QKZWSFWRFOQGDR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|