C20H17N3O7 — CID 108745385
3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]benzoic acid (PubChem CID 108745385) has the molecular formula C20H17N3O7 and a molecular weight of 411.37 g/mol. Its IUPAC name is 3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]benzoic acid.
| Compound Name | 3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108745385 |
| Molecular Formula | C20H17N3O7 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 3-[[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]methyl]benzoic acid |
| SMILES | O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H17N3O7/c24-17(21-11-12-3-1-4-13(9-12)20(27)28)5-2-8-22-18(25)15-7-6-14(23(29)30)10-16(15)19(22)26/h1,3-4,6-7,9-10H,2,5,8,11H2,(H,21,24)(H,27,28) |
| InChIKey | GDJPLZSPBBYVOY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|