C19H20ClN3O4 — CID 19829514
2-[4-(benzylamino)butyl]-5-nitroisoindole-1,3-dione;hydrochloride (PubChem CID 19829514) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-[4-(benzylamino)butyl]-5-nitroisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-(benzylamino)butyl]-5-nitroisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 19829514 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[4-(benzylamino)butyl]-5-nitroisoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCCCNCc1ccccc1 |
| InChI | InChI=1S/C19H19N3O4.ClH/c23-18-16-9-8-15(22(25)26)12-17(16)19(24)21(18)11-5-4-10-20-13-14-6-2-1-3-7-14;/h1-3,6-9,12,20H,4-5,10-11,13H2;1H |
| InChIKey | LGVTXTUMAJZGDO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|