C14H13KN2O6 — CID 24940918
potassium 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 24940918) has the molecular formula C14H13KN2O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is potassium 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | potassium 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 24940918 |
| Molecular Formula | C14H13KN2O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | potassium 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | O=C([O-])CCCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O.[K+] |
| InChI | InChI=1S/C14H14N2O6.K/c17-12(18)4-2-1-3-7-15-13(19)10-6-5-9(16(21)22)8-11(10)14(15)20;/h5-6,8H,1-4,7H2,(H,17,18);/q;+1/p-1 |
| InChIKey | DRMLDYRCUFOTTR-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|