C10H5N2O6- — CID 3712827
2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 3712827) has the molecular formula C10H5N2O6- and a molecular weight of 249.16 g/mol. Its IUPAC name is 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 3712827 |
| Molecular Formula | C10H5N2O6- |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C([O-])CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C10H6N2O6/c13-8(14)4-11-9(15)6-2-1-5(12(17)18)3-7(6)10(11)16/h1-3H,4H2,(H,13,14)/p-1 |
| InChIKey | IYUGAIHDSMCVCC-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|