C16H9IN2O5 — CID 27999930
2-[2-(4-iodophenyl)-2-oxoethyl]-5-nitroisoindole-1,3-dione (PubChem CID 27999930) has the molecular formula C16H9IN2O5 and a molecular weight of 436.16 g/mol. Its IUPAC name is 2-[2-(4-iodophenyl)-2-oxoethyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-(4-iodophenyl)-2-oxoethyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 27999930 |
| Molecular Formula | C16H9IN2O5 |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 2-[2-(4-iodophenyl)-2-oxoethyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H9IN2O5/c17-10-3-1-9(2-4-10)14(20)8-18-15(21)12-6-5-11(19(23)24)7-13(12)16(18)22/h1-7H,8H2 |
| InChIKey | CPGLAHAGMKCBQN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|