C17H10N4O5 — CID 2706886
N-(2-cyanophenyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 2706886) has the molecular formula C17H10N4O5 and a molecular weight of 350.29 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 2706886 |
| Molecular Formula | C17H10N4O5 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-(2-cyanophenyl)-2-(5-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C17H10N4O5/c18-8-10-3-1-2-4-14(10)19-15(22)9-20-16(23)12-6-5-11(21(25)26)7-13(12)17(20)24/h1-7H,9H2,(H,19,22) |
| InChIKey | DKFWWUUIOGDXDW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|