C16H9N3O4 — CID 2706843
2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]benzonitrile (PubChem CID 2706843) has the molecular formula C16H9N3O4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]benzonitrile.
| Compound Name | 2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 2706843 |
| Molecular Formula | C16H9N3O4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C16H9N3O4/c17-8-10-3-1-2-4-11(10)9-18-15(20)13-6-5-12(19(22)23)7-14(13)16(18)21/h1-7H,9H2 |
| InChIKey | UOEVRNMLMYOXLM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|