C11H8N2O5 — CID 63040575
3-(5-nitro-1,3-dioxoisoindol-2-yl)propanal (PubChem CID 63040575) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 3-(5-nitro-1,3-dioxoisoindol-2-yl)propanal.
| Compound Name | 3-(5-nitro-1,3-dioxoisoindol-2-yl)propanal |
|---|---|
| PubChem CID | 63040575 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-(5-nitro-1,3-dioxoisoindol-2-yl)propanal |
| SMILES | O=CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C11H8N2O5/c14-5-1-4-12-10(15)8-3-2-7(13(17)18)6-9(8)11(12)16/h2-3,5-6H,1,4H2 |
| InChIKey | KUJVTZTYRIYYBD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|