C12H11BrN2O4 — CID 2735540
2-(4-bromobutyl)-5-nitroisoindole-1,3-dione (PubChem CID 2735540) has the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. Its IUPAC name is 2-(4-bromobutyl)-5-nitroisoindole-1,3-dione.
| Compound Name | 2-(4-bromobutyl)-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2735540 |
| Molecular Formula | C12H11BrN2O4 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 2-(4-bromobutyl)-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCCCBr |
| InChI | InChI=1S/C12H11BrN2O4/c13-5-1-2-6-14-11(16)9-4-3-8(15(18)19)7-10(9)12(14)17/h3-4,7H,1-2,5-6H2 |
| InChIKey | MQBKILMXULFSRI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|