C14H14N2O6 — CID 3089465
6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoic acid (PubChem CID 3089465) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoic acid.
| Compound Name | 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 3089465 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-(5-nitro-1,3-dioxoisoindol-2-yl)hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C14H14N2O6/c17-12(18)4-2-1-3-7-15-13(19)10-6-5-9(16(21)22)8-11(10)14(15)20/h5-6,8H,1-4,7H2,(H,17,18) |
| InChIKey | NXXKBRGGMSPDNK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|