C19H21ClN4O6 — CID 108569655
2-[4-[4-(3-chloropropanoyl)piperazin-1-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione (PubChem CID 108569655) has the molecular formula C19H21ClN4O6 and a molecular weight of 436.85 g/mol. Its IUPAC name is 2-[4-[4-(3-chloropropanoyl)piperazin-1-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[4-[4-(3-chloropropanoyl)piperazin-1-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108569655 |
| Molecular Formula | C19H21ClN4O6 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[4-[4-(3-chloropropanoyl)piperazin-1-yl]-4-oxobutyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C(CCCl)N1CCN(C(=O)CCCN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)CC1 |
| InChI | InChI=1S/C19H21ClN4O6/c20-6-5-17(26)22-10-8-21(9-11-22)16(25)2-1-7-23-18(27)14-4-3-13(24(29)30)12-15(14)19(23)28/h3-4,12H,1-2,5-11H2 |
| InChIKey | QPVSIVPVYVQWKO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|