C19H19F3N4O6 — CID 108932514
5-nitro-2-[4-oxo-4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]butyl]isoindole-1,3-dione (PubChem CID 108932514) has the molecular formula C19H19F3N4O6 and a molecular weight of 456.38 g/mol. Its IUPAC name is 5-nitro-2-[4-oxo-4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[4-oxo-4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108932514 |
| Molecular Formula | C19H19F3N4O6 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 5-nitro-2-[4-oxo-4-[4-(2,2,2-trifluoroacetyl)-1,4-diazepan-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)N1CCCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H19F3N4O6/c20-19(21,22)18(30)24-7-2-6-23(9-10-24)15(27)3-1-8-25-16(28)13-5-4-12(26(31)32)11-14(13)17(25)29/h4-5,11H,1-3,6-10H2 |
| InChIKey | KNSZFLFLHCBCPW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|