C20H22N4O7 — CID 108569661
prop-2-enyl 4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperazine-1-carboxylate (PubChem CID 108569661) has the molecular formula C20H22N4O7 and a molecular weight of 430.42 g/mol. Its IUPAC name is prop-2-enyl 4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108569661 |
| Molecular Formula | C20H22N4O7 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | prop-2-enyl 4-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoyl]piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)CCCN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)CC1 |
| InChI | InChI=1S/C20H22N4O7/c1-2-12-31-20(28)22-10-8-21(9-11-22)17(25)4-3-7-23-18(26)15-6-5-14(24(29)30)13-16(15)19(23)27/h2,5-6,13H,1,3-4,7-12H2 |
| InChIKey | YKBIAJHLPWWFMO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 130.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|