C19H22N4O7 — CID 108569641
2-methylpropyl 4-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperazine-1-carboxylate (PubChem CID 108569641) has the molecular formula C19H22N4O7 and a molecular weight of 418.41 g/mol. Its IUPAC name is 2-methylpropyl 4-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108569641 |
| Molecular Formula | C19H22N4O7 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-methylpropyl 4-[2-(5-nitro-1,3-dioxoisoindol-2-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(C(=O)CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)CC1 |
| InChI | InChI=1S/C19H22N4O7/c1-12(2)11-30-19(27)21-7-5-20(6-8-21)16(24)10-22-17(25)14-4-3-13(23(28)29)9-15(14)18(22)26/h3-4,9,12H,5-8,10-11H2,1-2H3 |
| InChIKey | QOTVJGXMMUACDI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 130.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|