C24H21N5O5 — CID 108742590
2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione (PubChem CID 108742590) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108742590 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[2-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-2-oxoethyl]-5-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(N2CCN(C(=O)CN3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H21N5O5/c1-15-12-21(25-20-5-3-2-4-17(15)20)26-8-10-27(11-9-26)22(30)14-28-23(31)18-7-6-16(29(33)34)13-19(18)24(28)32/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | KSBBBHCXYKMLEE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 116.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|