C29H24N4O3 — CID 108765052
2-[4-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]phenyl]isoindole-1,3-dione (PubChem CID 108765052) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-[4-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108765052 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[4-[4-(4-methylquinolin-2-yl)piperazine-1-carbonyl]phenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2CCN(C(=O)c3ccc(N4C(=O)c5ccccc5C4=O)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C29H24N4O3/c1-19-18-26(30-25-9-5-4-6-22(19)25)31-14-16-32(17-15-31)27(34)20-10-12-21(13-11-20)33-28(35)23-7-2-3-8-24(23)29(33)36/h2-13,18H,14-17H2,1H3 |
| InChIKey | MHTLZSWFMAIBOC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|