C27H28N4O3 — CID 108765060
2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 108765060) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108765060 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-[3-methyl-1-[4-(4-methylquinolin-2-yl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2CCN(C(=O)C(C(C)C)N3C(=O)c4ccccc4C3=O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C27H28N4O3/c1-17(2)24(31-25(32)20-9-4-5-10-21(20)26(31)33)27(34)30-14-12-29(13-15-30)23-16-18(3)19-8-6-7-11-22(19)28-23/h4-11,16-17,24H,12-15H2,1-3H3 |
| InChIKey | ASUCFAVBBNDNSJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|