C22H23BrN4O3 — CID 55675537
2-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 55675537) has the molecular formula C22H23BrN4O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 2-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55675537 |
| Molecular Formula | C22H23BrN4O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-[1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)C(C(=O)N1CCN(c2ccc(Br)cn2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23BrN4O3/c1-14(2)19(27-20(28)16-5-3-4-6-17(16)21(27)29)22(30)26-11-9-25(10-12-26)18-8-7-15(23)13-24-18/h3-8,13-14,19H,9-12H2,1-2H3 |
| InChIKey | VPRQPCKPWMVSQW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|