C18H24ClN3O3 — CID 119375549
2-[1-(4-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione;hydrochloride (PubChem CID 119375549) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[1-(4-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[1-(4-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119375549 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[1-(4-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione;hydrochloride |
| SMILES | CC(C)C(C(=O)N1CCC(N)CC1)N1C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C18H23N3O3.ClH/c1-11(2)15(18(24)20-9-7-12(19)8-10-20)21-16(22)13-5-3-4-6-14(13)17(21)23;/h3-6,11-12,15H,7-10,19H2,1-2H3;1H |
| InChIKey | TVHWTSKWQYVHSV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|