C20H27N3O5S — CID 56534036
2-[3-methyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 56534036) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[3-methyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-methyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 56534036 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[3-methyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)C(C(=O)N1CCN(CCS(C)(=O)=O)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H27N3O5S/c1-14(2)17(23-18(24)15-6-4-5-7-16(15)19(23)25)20(26)22-10-8-21(9-11-22)12-13-29(3,27)28/h4-7,14,17H,8-13H2,1-3H3 |
| InChIKey | JNVPAZVVZGXQHX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|