C23H23F2N3O5S — CID 55341656
2-[1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione (PubChem CID 55341656) has the molecular formula C23H23F2N3O5S and a molecular weight of 491.52 g/mol. Its IUPAC name is 2-[1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55341656 |
| Molecular Formula | C23H23F2N3O5S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-methyl-1-oxobutan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C)C(C(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23F2N3O5S/c1-14(2)20(28-21(29)16-5-3-4-6-17(16)22(28)30)23(31)26-9-11-27(12-10-26)34(32,33)15-7-8-18(24)19(25)13-15/h3-8,13-14,20H,9-12H2,1-2H3 |
| InChIKey | XEHANZHDYGNHPC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|