C21H20FN3O5S — CID 55344219
2-[1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 55344219) has the molecular formula C21H20FN3O5S and a molecular weight of 445.47 g/mol. Its IUPAC name is 2-[1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55344219 |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-[1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20FN3O5S/c1-14(25-20(27)17-7-2-3-8-18(17)21(25)28)19(26)23-9-11-24(12-10-23)31(29,30)16-6-4-5-15(22)13-16/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | LIWKRIJELCLEIE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|