C21H20N4O7S — CID 55339490
2-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione (PubChem CID 55339490) has the molecular formula C21H20N4O7S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 55339490 |
| Molecular Formula | C21H20N4O7S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]-1-oxopropan-2-yl]-4-nitroisoindole-1,3-dione |
| SMILES | CC(C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C21H20N4O7S/c1-14(24-20(27)16-8-5-9-17(25(29)30)18(16)21(24)28)19(26)22-10-12-23(13-11-22)33(31,32)15-6-3-2-4-7-15/h2-9,14H,10-13H2,1H3 |
| InChIKey | ZZRHZXUHDIXAPG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 138.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|