C13H17BrN2O3S — CID 107903486
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-bromopropan-1-one (PubChem CID 107903486) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-bromopropan-1-one.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-bromopropan-1-one |
|---|---|
| PubChem CID | 107903486 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-bromopropan-1-one |
| SMILES | CC(Br)C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H17BrN2O3S/c1-11(14)13(17)15-7-9-16(10-8-15)20(18,19)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3 |
| InChIKey | NMHKZUMYSORNJT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|