C18H28N3O3S+ — CID 9249678
(2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-2-piperidin-1-ium-1-ylpropan-1-one (PubChem CID 9249678) has the molecular formula C18H28N3O3S+ and a molecular weight of 366.51 g/mol. Its IUPAC name is (2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-2-piperidin-1-ium-1-ylpropan-1-one.
| Compound Name | (2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-2-piperidin-1-ium-1-ylpropan-1-one |
|---|---|
| PubChem CID | 9249678 |
| Molecular Formula | C18H28N3O3S+ |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (2S)-1-[4-(benzenesulfonyl)piperazin-1-yl]-2-piperidin-1-ium-1-ylpropan-1-one |
| SMILES | C[C@@H](C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)[NH+]1CCCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c1-16(19-10-6-3-7-11-19)18(22)20-12-14-21(15-13-20)25(23,24)17-8-4-2-5-9-17/h2,4-5,8-9,16H,3,6-7,10-15H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | DTLGSGQSPIWGOX-INIZCTEOSA-O |
| XLogP | -0.02 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |