C18H27ClN3O3S+ — CID 9318787
(2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-piperidin-1-ylpropan-1-one (PubChem CID 9318787) has the molecular formula C18H27ClN3O3S+ and a molecular weight of 400.95 g/mol. Its IUPAC name is (2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-piperidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 9318787 |
| Molecular Formula | C18H27ClN3O3S+ |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-piperidin-1-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCCCC1)[NH+]1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26ClN3O3S/c1-15(18(23)21-9-3-2-4-10-21)20-11-13-22(14-12-20)26(24,25)17-7-5-16(19)6-8-17/h5-8,15H,2-4,9-14H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | YJMKWPNETPQRSG-OAHLLOKOSA-O |
| XLogP | 0.63 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |