C17H28N3O3S+ — CID 9493907
(2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-tert-butylpropanamide (PubChem CID 9493907) has the molecular formula C17H28N3O3S+ and a molecular weight of 354.50 g/mol. Its IUPAC name is (2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-tert-butylpropanamide.
| Compound Name | (2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 9493907 |
| Molecular Formula | C17H28N3O3S+ |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2R)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-tert-butylpropanamide |
| SMILES | C[C@H](C(=O)NC(C)(C)C)[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H27N3O3S/c1-14(16(21)18-17(2,3)4)19-10-12-20(13-11-19)24(22,23)15-8-6-5-7-9-15/h5-9,14H,10-13H2,1-4H3,(H,18,21)/p+1/t14-/m1/s1 |
| InChIKey | OULJVXDMHSFMDB-CQSZACIVSA-O |
| XLogP | -0.12 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |