C15H22N3O5S+ — CID 8692674
methyl N-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]propanoyl]carbamate (PubChem CID 8692674) has the molecular formula C15H22N3O5S+ and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl N-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]propanoyl]carbamate.
| Compound Name | methyl N-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]propanoyl]carbamate |
|---|---|
| PubChem CID | 8692674 |
| Molecular Formula | C15H22N3O5S+ |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl N-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]propanoyl]carbamate |
| SMILES | COC(=O)NC(=O)[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O5S/c1-12(14(19)16-15(20)23-2)17-8-10-18(11-9-17)24(21,22)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H,16,19,20)/p+1/t12-/m0/s1 |
| InChIKey | PZCFTVCBVOTSHU-LBPRGKRZSA-O |
| XLogP | -1.15 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |