C15H22FN4O4S+ — CID 8966358
(2R)-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(methylcarbamoyl)propanamide (PubChem CID 8966358) has the molecular formula C15H22FN4O4S+ and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 8966358 |
| Molecular Formula | C15H22FN4O4S+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (2R)-2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H21FN4O4S/c1-11(14(21)18-15(22)17-2)19-6-8-20(9-7-19)25(23,24)13-5-3-4-12(16)10-13/h3-5,10-11H,6-9H2,1-2H3,(H2,17,18,21,22)/p+1/t11-/m1/s1 |
| InChIKey | QPLDYPDPGXWLDN-LLVKDONJSA-O |
| XLogP | -1.44 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |