C10H10FNO2S — CID 3830927
1-(3-fluorophenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 3830927) has the molecular formula C10H10FNO2S and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 3830927 |
| Molecular Formula | C10H10FNO2S |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CC=CC1 |
| InChI | InChI=1S/C10H10FNO2S/c11-9-4-3-5-10(8-9)15(13,14)12-6-1-2-7-12/h1-5,8H,6-7H2 |
| InChIKey | XQABNOARMKARRI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|