C16H15Cl2FN2O4S2 — CID 55352199
1-(3,4-dichlorophenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine (PubChem CID 55352199) has the molecular formula C16H15Cl2FN2O4S2 and a molecular weight of 453.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(3,4-dichlorophenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 55352199 |
| Molecular Formula | C16H15Cl2FN2O4S2 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H15Cl2FN2O4S2/c17-15-5-4-14(11-16(15)18)27(24,25)21-8-6-20(7-9-21)26(22,23)13-3-1-2-12(19)10-13/h1-5,10-11H,6-9H2 |
| InChIKey | IPCWMVSLGLMYHC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |