C17H18F2N2O4S2 — CID 46633054
1-(4-fluoro-2-methylphenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine (PubChem CID 46633054) has the molecular formula C17H18F2N2O4S2 and a molecular weight of 416.47 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 46633054 |
| Molecular Formula | C17H18F2N2O4S2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)sulfonyl-4-(3-fluorophenyl)sulfonylpiperazine |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H18F2N2O4S2/c1-13-11-15(19)5-6-17(13)27(24,25)21-9-7-20(8-10-21)26(22,23)16-4-2-3-14(18)12-16/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | NIRPEJUNHMMYGH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |