C14H20FNO2S — CID 110738659
1-(4-fluoro-2-methylphenyl)sulfonyl-4,4-dimethylpiperidine (PubChem CID 110738659) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)sulfonyl-4,4-dimethylpiperidine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)sulfonyl-4,4-dimethylpiperidine |
|---|---|
| PubChem CID | 110738659 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)sulfonyl-4,4-dimethylpiperidine |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H20FNO2S/c1-11-10-12(15)4-5-13(11)19(17,18)16-8-6-14(2,3)7-9-16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | FYZTXNLMUGQOID-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |