C19H22F2N2O4S2 — CID 52559280
1,4-bis[(4-fluoro-2-methylphenyl)sulfonyl]-1,4-diazepane (PubChem CID 52559280) has the molecular formula C19H22F2N2O4S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1,4-bis[(4-fluoro-2-methylphenyl)sulfonyl]-1,4-diazepane.
| Compound Name | 1,4-bis[(4-fluoro-2-methylphenyl)sulfonyl]-1,4-diazepane |
|---|---|
| PubChem CID | 52559280 |
| Molecular Formula | C19H22F2N2O4S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1,4-bis[(4-fluoro-2-methylphenyl)sulfonyl]-1,4-diazepane |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(F)cc2C)CC1 |
| InChI | InChI=1S/C19H22F2N2O4S2/c1-14-12-16(20)4-6-18(14)28(24,25)22-8-3-9-23(11-10-22)29(26,27)19-7-5-17(21)13-15(19)2/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | RPRZDKJDDVVHMB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |