C12H17FN2O4S2 — CID 61132278
1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-3-sulfonamide (PubChem CID 61132278) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-3-sulfonamide.
| Compound Name | 1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 61132278 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)sulfonylpiperidine-3-sulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCCC(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H17FN2O4S2/c1-9-7-10(13)4-5-12(9)21(18,19)15-6-2-3-11(8-15)20(14,16)17/h4-5,7,11H,2-3,6,8H2,1H3,(H2,14,16,17) |
| InChIKey | AZVDOURYFXSWCY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |