C11H15FN2O4S2 — CID 61132900
1-(3-fluorophenyl)sulfonylpiperidine-3-sulfonamide (PubChem CID 61132900) has the molecular formula C11H15FN2O4S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonylpiperidine-3-sulfonamide.
| Compound Name | 1-(3-fluorophenyl)sulfonylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 61132900 |
| Molecular Formula | C11H15FN2O4S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonylpiperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(S(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C11H15FN2O4S2/c12-9-3-1-4-10(7-9)20(17,18)14-6-2-5-11(8-14)19(13,15)16/h1,3-4,7,11H,2,5-6,8H2,(H2,13,15,16) |
| InChIKey | HVGXPLLYSSVPHT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |