C11H14FN3O6S2 — CID 75400396
1-(3-fluoro-5-nitrophenyl)sulfonylpiperidine-3-sulfonamide (PubChem CID 75400396) has the molecular formula C11H14FN3O6S2 and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-(3-fluoro-5-nitrophenyl)sulfonylpiperidine-3-sulfonamide.
| Compound Name | 1-(3-fluoro-5-nitrophenyl)sulfonylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 75400396 |
| Molecular Formula | C11H14FN3O6S2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-(3-fluoro-5-nitrophenyl)sulfonylpiperidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(S(=O)(=O)c2cc(F)cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C11H14FN3O6S2/c12-8-4-9(15(16)17)6-11(5-8)23(20,21)14-3-1-2-10(7-14)22(13,18)19/h4-6,10H,1-3,7H2,(H2,13,18,19) |
| InChIKey | JFHAFNRHPLJCMM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|