C5H13N3O4S2 — CID 115897696
piperidine-1,3-disulfonamide (PubChem CID 115897696) has the molecular formula C5H13N3O4S2 and a molecular weight of 243.31 g/mol. Its IUPAC name is piperidine-1,3-disulfonamide.
| Compound Name | piperidine-1,3-disulfonamide |
|---|---|
| PubChem CID | 115897696 |
| Molecular Formula | C5H13N3O4S2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | piperidine-1,3-disulfonamide |
| SMILES | NS(=O)(=O)C1CCCN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C5H13N3O4S2/c6-13(9,10)5-2-1-3-8(4-5)14(7,11)12/h5H,1-4H2,(H2,6,9,10)(H2,7,11,12) |
| InChIKey | NMCRDUDEOJWJTR-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |