C6H13N3O3S — CID 43132049
1-sulfamoylpiperidine-3-carboxamide (PubChem CID 43132049) has the molecular formula C6H13N3O3S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-sulfamoylpiperidine-3-carboxamide.
| Compound Name | 1-sulfamoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43132049 |
| Molecular Formula | C6H13N3O3S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-sulfamoylpiperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C6H13N3O3S/c7-6(10)5-2-1-3-9(4-5)13(8,11)12/h5H,1-4H2,(H2,7,10)(H2,8,11,12) |
| InChIKey | IDHARFSZIKDUNG-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |