C12H15Br2N3O3S — CID 43257284
1-(4-amino-2,6-dibromophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 43257284) has the molecular formula C12H15Br2N3O3S and a molecular weight of 441.15 g/mol. Its IUPAC name is 1-(4-amino-2,6-dibromophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | 1-(4-amino-2,6-dibromophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43257284 |
| Molecular Formula | C12H15Br2N3O3S |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | 1-(4-amino-2,6-dibromophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(S(=O)(=O)c2c(Br)cc(N)cc2Br)C1 |
| InChI | InChI=1S/C12H15Br2N3O3S/c13-9-4-8(15)5-10(14)11(9)21(19,20)17-3-1-2-7(6-17)12(16)18/h4-5,7H,1-3,6,15H2,(H2,16,18) |
| InChIKey | OOBYTADBXNWDNA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|