C12H14F2N2O3S — CID 94017405
(3R)-1-(3,5-difluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 94017405) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is (3R)-1-(3,5-difluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(3,5-difluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94017405 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (3R)-1-(3,5-difluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(S(=O)(=O)c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C12H14F2N2O3S/c13-9-4-10(14)6-11(5-9)20(18,19)16-3-1-2-8(7-16)12(15)17/h4-6,8H,1-3,7H2,(H2,15,17)/t8-/m1/s1 |
| InChIKey | ZYKMDKCQBUANJW-MRVPVSSYSA-N |
| XLogP | 0.85 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |