C12H14ClFN2O3S — CID 18086440
1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 18086440) has the molecular formula C12H14ClFN2O3S and a molecular weight of 320.77 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | 1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 18086440 |
| Molecular Formula | C12H14ClFN2O3S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(S(=O)(=O)c2ccc(Cl)cc2F)C1 |
| InChI | InChI=1S/C12H14ClFN2O3S/c13-9-3-4-11(10(14)6-9)20(18,19)16-5-1-2-8(7-16)12(15)17/h3-4,6,8H,1-2,5,7H2,(H2,15,17) |
| InChIKey | HUXFPJUNYGXNOA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |